ChemNet > CAS > 82140-55-4 methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate
82140-55-4 methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate
| उत्पाद का नाम |
methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate |
| अंग्रेजी नाम |
methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate;methyl (2Z)-2-[(2,6-dichloropyridin-4-yl)carbonyl]-3-(methylamino)but-2-enoate; methyl 2-[(2,6-dichloropyridin-4-yl)carbonyl]-3-(methylamino)but-2-enoate |
| आणविक फार्मूला |
C12H12Cl2N2O3 |
| आण्विक वजन |
303.1413 |
| InChI |
InChI=1/C12H12Cl2N2O3/c1-6(15-2)10(12(18)19-3)11(17)7-4-8(13)16-9(14)5-7/h4-5,15H,1-3H3 |
| कैस रजिस्टी संख्या |
82140-55-4 |
| आणविक संरचना |
![82140-55-4 methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate](https://images-a.chemnet.com/suppliers/chembase/cas11/cas82140-55-4.gif)
|
| घनत्व |
1.34g/cm3 |
| गलनांक |
112℃ |
| उबलने का समय |
462.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.553 |
| फ्लैश प्वाइंट |
233.8°C |
| वाष्प का दबाव |
9.48E-09mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
